2,6-Di-tert-butyl-4-methylphenol
SIAL/34750 - purum, ≥99.0% (GC)
Synonym: 2,6-Di-tert-butyl-p-cresol; BHT; Butylated hydroxytoluene; Butylhydroxytoluene; DBPC
CAS Number: 128-37-0
Empirical Formula (Hill Notation): C15H24O
Molecular Weight: 220.35
EC Number: 204-881-4
MDL Number: MFCD00011644
Linear Formula: [(CH3)3C]2C6H2(CH3)OH
Product Type: Chemical
| assay | ≥99.0% (GC) |
| autoignition temp. | 878 °F |
| bp | 265 °C (lit.) |
| grade | purum |
| InChI | 1S/C15H24O/c1-10-8-11(14( |
| InChI key | NLZUEZXRPGMBCV-UHFFFAOYSA |
| mp | 68-72 °C |
| 69-73 °C (lit.) | |
| Quality Level | 200 ![]() |
| SMILES string | Cc1cc(c(O)c(c1)C(C)(C)C)C |
| solubility | methanol: 0.1 g/mL, clear, colorless |
| methanol: soluble 100 mg/mL, clear, colorless | |
| vapor density | 7.6 (vs air) |
| vapor pressure | <0.01 mmHg ( 20 °C) |
| Application: | 2,6-Di-tert-butyl-4-methylphenol may be used in the preparation of an organoaluminum compound, methylaluminum bis(2,6-di-tert-butyl-4-alkylphenoxide). |
| General description: | 2,6-Di-tert-butyl-4-methylphenol is an 4-alkylphenol. It is an antioxidant and exhibit toxicities mediated by oxidative metabolism to electrophilic quinone methides. It acts as Michael acceptor and its reaction with simple nucleophiles and proteins have been reported. Reaction of 2,6-di-tert-butyl-4-methylphenol with ytterbium(II)-benzophenon |
| Symbol | GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273 |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 2 |
| Flash Point(F) | 260.6 °F - open cup |
| Flash Point(C) | 127 °C - open cup |
| Purity | ≥99.0% (GC) |
| bp | 265 °C (lit.) |
| mp | 68-72 °C; 69-73 °C (lit.) |
| UNSPSC | 12352100 |


