Alternariol
SIAL/35758 - analytical standard
Synonym: 3,7,9-
CAS Number: 641-38-3
Empirical Formula (Hill Notation): C14H10O5
Molecular Weight: 258.23
MDL Number: MFCD00133068
Linear Formula: C14H10O5
Product Type: Chemical
| application(s) | cleaning products cosmetics food and beverages personal care |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C14H10O5/c1-6-2-7(15)5 |
| InChI key | CEBXXEKPIIDJHL-UHFFFAOYSA |
| Quality Level | 100  |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | Cc1cc(O)cc2OC(=O)c3c(O)cc |
| storage temp. | −20°C |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Analysis Note: | purity : ≥96.0% (HPLC) |
| Application: | Alternariol may be used as an analytical reference standard for the determination of the analyte in fruits, vegetables and cereals by various chromatography techniques. |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| General description: | Alternariol (AOH) is a mycotoxin produced by fungus Alternaria and a major plant pathogen found in a wide variety of fruits and cereals products. AOH is structurally characterized as a dibenzopyranone. |
| Reconstitution: | Dried down, ~100μg/mL after reconstitution with 1 mL of water |
| Symbol |  GHS06 |
| Signal word | Danger |
| Hazard statements | H300 + H310 + H330 |
| Precautionary statements | P262 - P280 - P301 + P310 + P330 - P302 + P352 + P310 - P304 + P340 + P310 |
| Hazard Codes | T+ |
| Risk Statements | 26/27/28 |
| Safety Statements | 28-36/37/39-45 |
| RIDADR | UN 3462 6.1 / PGI |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Storage Temp. | −20°C |
| UNSPSC | 85151701 |