Malathion
SIAL/36143 - PESTANAL®, analytical standard
CAS Number: 121-75-5
Empirical Formula (Hill Notation): C10H19O6PS2
Molecular Weight: 330.36
EC Number: 204-497-7
MDL Number: MFCD00036233
Linear Formula: C10H19O6PS2
Product Type: Chemical
| application(s) | agriculture environmental |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C10H19O6PS2/c1-5-15-9( |
| InChI key | JXSJBGJIGXNWCI-UHFFFAOYSA |
| product line | PESTANAL® |
| Quality Level | 100 ![]() |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | CCOC(=O)CC(SP(=S)(OC)OC)C |
| storage temp. | 2-8°C |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| General description: | Malathion is a commonly used organophosphate pesticide, which is generally sprayed on aquatic habitats in order to have a control over mosquitoes that carry malaria and the west nile virus. |
| Legal Information: | PESTANAL is a registered trademark of Merck KGaA, Darmstadt, Germany |
| Symbol | ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302 - H317 - H410 |
| Precautionary statements | P261 - P264 - P273 - P280 - P301 + P312 - P302 + P352 |
| Hazard Codes | Xn,N |
| Risk Statements | 22-43-50/53 |
| Safety Statements | 24-37-46-60-61 |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Storage Temp. | 2-8°C |
| UNSPSC | 41116107 |



