Metoxuron
SIAL/36164 - PESTANAL®, analytical standard
CAS Number: 19937-59-8
Empirical Formula (Hill Notation): C10H13ClN2O2
Molecular Weight: 228.68
EC Number: 243-433-2
MDL Number: MFCD00055444
Linear Formula: C10H13ClN2O2
Product Type: Chemical
| application(s) | agriculture environmental |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C10H13ClN2O2/c1-13(2)1 |
| InChI key | DSRNRYQBBJQVCW-UHFFFAOYSA |
| mp | 124-127 °C |
| product line | PESTANAL® |
| Quality Level | 100  |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | COc1ccc(NC(=O)N(C)C)cc1Cl |
| suitability | passes test for identity (NMR) |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable | |
| NMR: suitable |
| Application: | Metoxuron may be used as an analytical reference standard for the determination of the analyte in soil, aqueous samples, crops and vegetables by various chromatographic techniques. |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| General description: | Metoxuron is a phenylurea herbicide widely used for agricultural applications. |
| Legal Information: | PESTANAL is a registered trademark of Merck KGaA, Darmstadt, Germany |
| Symbol |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302 - H410 |
| Precautionary statements | P264 - P270 - P273 - P301 + P312 - P391 - P501 |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 2 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| mp | 124-127 °C |
| UNSPSC | 41116107 |