Tetrachlorocatechol
SIAL/36443 - technical, ≥95.0% (HPLC)
CAS Number: 1198-55-6
Empirical Formula (Hill Notation): C6H2Cl4O2
Molecular Weight: 247.89
MDL Number: MFCD00002190
Linear Formula: C6Cl4-1,2-(OH)2
Product Type: Chemical
| assay | ≥95.0% (HPLC) |
| functional group | chloro |
| grade | technical |
| InChI | 1S/C6H2Cl4O2/c7-1-2(8)4(1 |
| InChI key | RRBMVWQICIXSEO-UHFFFAOYSA |
| mp | 193-195 °C (lit.) |
| Quality Level | 100 ![]() |
| SMILES string | Oc1c(O)c(Cl)c(Cl)c(Cl)c1C |
| Application: | Tetrachlorocatechol was used to investigate the inhibition of various ureases by halogenated benzo- and naphthoquinones, potent inhibitors of pure ureases from Bacillus pasteurii and Canavalia ensiformis. It may be used to prepare the copper(II) complexes of the potentially tripodal N,N,O ligand 3,3-bis(1-methylimidazol- |
| General description: | Tetrachlorocatechol is a metabolite of pentachlorophenol. Acute toxicity of tetrachlorocatechol has been investigated in male and female mice. |
| Symbol | ![]() ![]() GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302 - H318 - H400 |
| Precautionary statements | P273 - P280 - P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-41 |
| Safety Statements | 26-39 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥95.0% (HPLC) |
| mp | 193-195 °C (lit.) |
| UNSPSC | 12352100 |




