Disperse Blue 14
SIAL/367648 - Dye content 97 %
CAS Number: 2475-44-7
Empirical Formula (Hill Notation): C16H14N2O2
Molecular Weight: 266.29
EC Number: 219-602-1
MDL Number: MFCD00001198
Linear Formula: C16H14N2O2
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 367648-5G
| λmax | 595 nm |
| 644 nm (2nd) | |
| application(s) | diagnostic assay manufacturing hematology histology |
| assay | 96.5-103.5% |
| composition | Dye content, 97% |
| form | powder |
| InChI | 1S/C16H14N2O2/c1-17-11-7- |
| InChI key | QOSTVEDABRQTSU-UHFFFAOYSA |
| mp | 220-222 °C (lit.) |
| Quality Level | 100  |
| SMILES string | CNc1ccc(NC)c2C(=O)c3ccccc |
| solubility | acetonitrile: 10 mg/mL |
| storage temp. | room temp |
| Packaging: | 5, 25 g in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 96.5-103.5% |
| mp | 220-222 °C (lit.) |
| Storage Temp. | room temp |
| Colour Index Number | 61500 |
| UNSPSC | 12171500 |