Guazatine acetate salt
SIAL/37915 - PESTANAL®, analytical standard
CAS Number: 115044-19-4
MDL Number: MFCD01724079
Product Type: Chemical
| application(s) | agriculture environmental |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C18H41N7/c19-17(20)24- |
| InChI key | RONFGUROBZGJKP-UHFFFAOYSA |
| product line | PESTANAL® |
| Quality Level | 100 ![]() |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | NC(=N)NCCCCCCCCNCCCCCCCCN |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Guazatine acetate salt has been used as an analytical reference standard in the detection and separation of guazatine residues in commercial citrus fruits using high performance liquid chromatography (HPLC) coupled with mass spectrometry (MS/MS). |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Legal Information: | PESTANAL is a registered trademark of Merck KGaA, Darmstadt, Germany |
| Symbol | ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H302 + H312 - H330 - H400 |
| Precautionary statements | P273 - P280 - P301 + P312 + P330 - P302 + P352 + P312 - P304 + P340 + P310 |
| Hazard Codes | T+,N |
| Risk Statements | 21/22-26-50/53 |
| Safety Statements | 28-36/37-45-60-61 |
| RIDADR | UN2811 - class 6.1 - PG 1 - EHS - Toxic solids, organic, n.o.s., |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| UNSPSC | 41116107 |



