N,N-Dimethylformamide di-tert-butyl acetal
SIAL/40263 - technical, ≥90% (GC)
Synonym: 1,1-Di-tert-butoxy-N,N-dimethylmethylamine; 1,1-Di-tert-butoxytrimethylamine
CAS Number: 36805-97-7
Empirical Formula (Hill Notation): C11H25NO2
Molecular Weight: 203.32
EC Number: 253-222-7
MDL Number: MFCD00015002
Linear Formula: (CH3)2NCH[OC(CH3)3]2
Product Type: Chemical
| assay | ≥90% (GC) |
| bp | 56-57 °C/8 mmHg (lit.) |
| density | 0.848 g/mL at 25 °C (lit.) |
| form | liquid |
| functional group | amine |
| ether | |
| grade | technical |
| InChI | 1S/C11H25NO2/c1-10(2,3)13 |
| InChI key | DBNQIOANXZVWIP-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| refractive index | n |
| SMILES string | CN(C)C(OC(C)(C)C)OC(C)(C) |
| Application: | N,N-Dimethylformamide di-tert-butyl acetal may be used in the synthesis of following: • (S)-2-(1-tert-butoxycarbonyl-2-{4-[2-( • 3-O-tert-butylmorphine • tert-butylesters of pyrrole- and indolecarboxylic acids |
| Other Notes: | Review; synthesis of tert-butyl esters. |
| Packaging: | 10, 50 mL in glass bottle |
| Symbol | ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226 - H315 - H319 - H335 |
| Precautionary statements | P210 - P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 1993C 3 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 95.0 °F - closed cup |
| Flash Point(C) | 35 °C - closed cup |
| Purity | ≥90% (GC) |
| bp | 56-57 °C/8 mmHg (lit.) |
| Density | 0.848 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352100 |



