3,4-Dimethylhexane
SIAL/40512 - analytical standard
CAS Number: 583-48-2
Empirical Formula (Hill Notation): C8H18
Molecular Weight: 114.23
EC Number: 209-504-7
MDL Number: MFCD00039927
Linear Formula: CH3CH2CH(CH3)CH(CH3)CH2CH3
Product Type: Chemical
| application(s) | petroleum |
| assay | ≥99.0% (GC) |
| bp | 119 °C (lit.) |
| density | 0.72 g/mL at 25 °C (lit.) |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C8H18/c1-5-7(3)8(4)6-2 |
| InChI key | RNTWWGNZUXGTAX-UHFFFAOYSA |
| Quality Level | 100  |
| refractive index | n |
| n |
|
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | CCC(C)C(C)CC |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Symbol |     GHS02,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H225 - H304 - H315 - H336 - H410 |
| Precautionary statements | P210 - P273 - P301 + P310 + P331 - P302 + P352 |
| Hazard Codes | F,Xn |
| Risk Statements | 11-36/37/38-65 |
| Safety Statements | 16-26-36-62 |
| RIDADR | UN1262 - class 3 - PG 2 - Octanes |
| WGK Germany | WGK 2 |
| Flash Point(F) | 42.8 °F - closed cup |
| Flash Point(C) | 6 °C - closed cup |
| Purity | ≥99.0% (GC) |
| bp | 119 °C (lit.) |
| Density | 0.72 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 41116107 |