Bis(4-methylpentyl)phthalate
SIAL/41260 - analytical standard
Synonym: Phthalic acid bis(4-methylpentyl) ester
CAS Number: 259139-51-0
Empirical Formula (Hill Notation): C20H30O4
Molecular Weight: 334.45
MDL Number: MFCD00072270
Linear Formula: C20H30O4
Product Type: Chemical
application(s) | environmental |
assay | ≥95.0% (GC) |
format | neat |
grade | analytical standard |
InChI | 1S/C20H30O4/c1-15(2)9-7-1 |
InChI key | ALEROMXYYSQFLX-UHFFFAOYSA |
Quality Level | 100 |
refractive index | n |
shelf life | limited shelf life, expiry date on the label |
SMILES string | O=C(OCCCC(C)C)C1=CC=CC=C1 |
storage temp. | 2-8°C |
technique(s) | gas chromatography (GC): suitable |
HPLC: suitable |
Symbol | GHS08 |
Signal word | Danger |
Hazard statements | H360FD |
Precautionary statements | P201 - P308 + P313 |
RIDADR | NONH for all modes of transport |
WGK Germany | WGK 3 |
Purity | ≥95.0% (GC) |
Refractive Index | n |
Storage Temp. | 2-8°C |
UNSPSC | 77101502 |