Synonym: (9Z)9-Octadecenoic acid 1,2,3-propanetriyl ester; 1,2,3-Tri(cis-9-octadecenoyl)glycerol; Glycerol trioleate; Glycerol triolein; Oleic acid triglyceride; Oleic triglyceride; TG(18:1(9Z)/18:1(9Z)/18:1(9Z)); Triolein
CAS Number: 122-32-7
Empirical Formula (Hill Notation): C57H104O6
Molecular Weight: 885.43
EC Number: 204-534-7
MDL Number: MFCD00137563
Linear Formula: (C17H33COOCH2)2CHOCOC17H33
Product Type: Chemical
| application(s) |
food and beverages |
| assay |
≥98.5% (GC) |
| bp |
235-240 °C/18 mmHg (lit.) |
| density |
0.91 g/mL (lit.) |
| format |
neat |
| functional group |
ester |
| grade |
analytical standard |
| impurities |
≤1.0% water |
| InChI |
1S/C57H104O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-55(58)61-52-54(63-57(60)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)53-62-56(59)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h25-30,54H,4-24,31-53H2,1-3H3/b28-25-,29-26-,30-27- |
| InChI key |
PHYFQTYBJUILEZ-IUPFWZBJSA-N |
| Quality Level |
100  |
| refractive index |
n20/D 1.468-1.470 |
| shelf life |
limited shelf life, expiry date on the label |
| SMILES string |
[H]C(COC(CCCCCCC/C=CCCCCCCCC)=O)(OC(CCCCCCC/C=CCCCCCCCC)=O)COC(CCCCCCC/C=CCCCCCCCC)=O |
| storage temp. |
−20°C |
| technique(s) |
gas chromatography (GC): suitable |
| |
HPLC: suitable |
| Application: |
Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Risk Statements |
53 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
awg |
| Flash Point(F) |
626.0 °F - closed cup |
| Flash Point(C) |
330.0 °C - closed cup |
| Purity |
≥98.5% (GC) |
| bp |
235-240 °C/18 mmHg (lit.) |
| Density |
0.91 g/mL (lit.) |
| Refractive Index |
n20/D 1.468-1.470 |
| Storage Temp. |
−20°C |
| UNSPSC |
85151701 |