Diisopropyl phthalate
SIAL/42117 - analytical standard
Synonym: 1,2-
CAS Number: 605-45-8
Empirical Formula (Hill Notation): C14H18O4
Molecular Weight: 250.29
EC Number: 210-086-3
MDL Number: MFCD00053717
Linear Formula: C14H18O4
Product Type: Chemical
| application(s) | environmental |
| assay | ≥98.0% (GC) |
| density | 1.063 g/mL at 20 °C (lit.) |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C14H18O4/c1-9(2)17-13( |
| InChI key | QWDBCIAVABMJPP-UHFFFAOYSA |
| Quality Level | 100  |
| refractive index | n |
| n |
|
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | CC(C)OC(=O)c1ccccc1C(=O)O |
| Application: | Diisopropyl phthalate may be used as an analytical standard for the determination of the analyte in meter dose inhalers (MDI) and children′s plastic toys by gas chromatography-tandem mass spectrometry (GC-MS/MS) technique. |
| General description: | Diisopropyl phthalate belongs to the class of phthalate esters, which are typically utilized as plasticizers to improve the flexibility of plastics in a broad range of household and consumer products. It is regarded as a potential endocrine disruptor. |
| Symbol |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 - H351 |
| Precautionary statements | P201 - P302 + P352 - P305 + P351 + P338 - P308 + P313 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98.0% (GC) |
| Density | 1.063 g/mL at 20 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352200 |