Synonym: (−)-Epicatechin (4β-8)-(−)-epicatechin; 4,8″-Bi-[(+)-epicatechin]; cis,cis″-4,8″-Bi(3,3′,4′,5,7-pentahydroxyflavane); Proanthocyanidin B2
CAS Number: 29106-49-8
Empirical Formula (Hill Notation): C30H26O12
Molecular Weight: 578.52
MDL Number: MFCD01861513
Linear Formula: C30H26O12
Product Type: Chemical
| application(s) |
food and beverages |
| assay |
≥90% (HPLC) |
| format |
neat |
| grade |
analytical standard |
| InChI |
1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26-,27-,28-,29-/m1/s1 |
| InChI key |
XFZJEEAOWLFHDH-NFJBMHMQSA-N |
| Quality Level |
100  |
| SMILES string |
O[C@@H]1Cc2c(O)cc(O)c([C@@H]3[C@@H](O)[C@H](Oc4cc(O)cc(O)c34)c5ccc(O)c(O)c5)c2O[C@@H]1c6ccc(O)c(O)c6 |
| storage temp. |
2-8°C |
| technique(s) |
gas chromatography (GC): suitable |
| |
HPLC: suitable |
| Application: |
Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| General description: |
Procyanidin B2 is a B type of proanthocyanidin, that is present in plants, especially in grape seeds, apples and cacao seeds, which is known to possess anti-inflammatory properties and antioxidant properties. |
| Packaging: |
Bottomless glass bottle. Contents are inside inserted fused cone. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥90% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
85151701 |
