Oleanolic acid
SIAL/42515 - analytical standard
CAS Number: 508-02-1
Empirical Formula (Hill Notation): C30H48O3
Molecular Weight: 456.70
EC Number: 208-081-6
MDL Number: MFCD00064914
Linear Formula: C30H48O3
Product Type: Chemical
| application(s) | food and beverages |
| assay | ≥97.0% (HPLC) |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C30H48O3/c1-25(2)14-16 |
| InChI key | MIJYXULNPSFWEK-GTOFXWBISA |
| mp | >300 °C (lit.) |
| Quality Level | 100 ![]() |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | [H][C@@]12CC(C)(C)CC[C@@] |
| storage temp. | 2-8°C |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Biochem/physiol Actions: | Triterpenoid isolated from medicinal plants. Antitumor and hepatoprotective agent. Oleanolic acid has therapeutic potential for neurodegenerative diseases. |
| Packaging: | Bottomless glass bottle. Contents are inside inserted fused cone. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥97.0% (HPLC) |
| mp | >300 °C (lit.) |
| Storage Temp. | 2-8°C |
| UNSPSC | 85151701 |

