Farnesol
SIAL/43348 - mixture of isomers, stabilized, analytical standard
Synonym: 3,7,11-
CAS Number: 4602-84-0
Empirical Formula (Hill Notation): C15H26O
Molecular Weight: 222.37
MDL Number: MFCD00002918
Linear Formula: (CH3)2C=CHCH2CH2C(CH3)=CHCH2CH2C(CH3)=CHCH2OH
Product Type: Chemical
| application(s) | cleaning products cosmetics environmental flavors and fragrances food and beverages personal care |
| assay | ≥95.0% (GC) |
| bp | 149 °C/4 mmHg (lit.) |
| contains | α-tocopherol (synthetic stabilizer) |
| density | 0.886 g/mL at 20 °C (lit.) |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C15H26O/c1-13(2)7-5-8- |
| InChI key | CRDAMVZIKSXKFV-YFVJMOTDSA |
| Quality Level | 100 ![]() |
| refractive index | n |
| n |
|
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | C/C(CC/C=C(C)/CCC=C(C)C)= |
| storage temp. | 2-8°C |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| General description: | Farnesol is a sesquiterpenoid, acting as a quorum-sensing molecule that inhibits filamentation in Candida albicans. It can exhibit chemotherapeutic activity toward pancreatic and other cancers. |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261 - P272 - P280 - P302 + P352 - P333 + P313 - P362 + P364 |
| Hazard Codes | Xi |
| Risk Statements | 43 |
| Safety Statements | 36/37 |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 204.8 °F - closed cup |
| Flash Point(C) | 96.00 °C - closed cup |
| Purity | ≥95.0% (GC) |
| bp | 149 °C/4 mmHg (lit.) |
| Density | 0.886 g/mL at 20 °C (lit.) |
| Refractive Index | n |
| Storage Temp. | 2-8°C |
| UNSPSC | 85151701 |


