Synonym: Reserpine; (3β, 16β, 17α, 18β, 20α)-11,17-Dimethoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]yohimban-16-carboxylic acid methyl ester
CAS Number: 50-55-5
Empirical Formula (Hill Notation): C33H40N2O9
Molecular Weight: 608.68
MDL Number: MFCD00005091
Linear Formula: C33H40N2O9
Product Type: Chemical
| concentration |
5 mg/L in water: isopropyl alcohol (1:1) |
| grade |
analytical standard |
| InChI |
1S/C33H40N2O9/c1-38-19-7-8-20-21-9-10-35-16-18-13-27(44-32(36)17-11-25(39-2)30(41-4)26(12-17)40-3)31(42-5)28(33(37)43-6)22(18)15-24(35)29(21)34-23(20)14-19/h7-8,11-12,14,18,22,24,27-28,31,34H,9-10,13,15-16H2,1-6H3/t18-,22+,24-,27-,28+,31+/m1/s1 |
| InChI key |
QEVHRUUCFGRFIF-MDEJGZGSSA-N |
| mp |
~265 °C (dec.) |
| Quality Level |
100  |
| shelf life |
limited shelf life, expiry date on the label |
| SMILES string |
CO[C@H]1[C@@H](C[C@@H]2CN3CCc4c([nH]c5cc(OC)ccc45)[C@H]3C[C@@H]2[C@@H]1C(=O)OC)OC(=O)c6cc(OC)c(OC)c(OC)c6 |
| storage temp. |
2-8°C |
| suitability |
corresponds for mass spectrometry |
| technique(s) |
LC/MS: suitable |
| Application: |
It was used as mass recalibration standard in coupling capillary electrophoresis with electrospray ionization time-of-flight mass spectrometry (CE-TOFMS) to overcome the problem of decreasing the sensitivity during the detection of metabolome differential display. |
| Biochem/physiol Actions: |
Inhibits vesicular uptake of catecholamines and serotonin. |
| General description: |
Reserpine is a 36 carbon indole alkaloid mostly used as a tranquilizing agent in medicine. It is mostly used as drug for hypertension. |
| Symbol |
  GHS02,GHS07 |
| Signal word |
Danger |
| Hazard statements |
H225 - H319 - H336 |
| Precautionary statements |
P210 - P305 + P351 + P338 |
| Hazard Codes |
Xi |
| Risk Statements |
10-36-67 |
| Safety Statements |
26 |
| RIDADR |
UN1219 - class 3 - PG 2 - Isopropanol, solution |
| WGK Germany |
WGK 1 |
| Flash Point(F) |
71.6 °F - closed cup |
| Flash Point(C) |
22.0 °C - closed cup |
| mp |
~265 °C (dec.) |
| Storage Temp. |
2-8°C |
| UNSPSC |
41121800 |
