Octamethylcyclotetrasiloxane
SIAL/43883 - analytical standard
CAS Number: 556-67-2
Empirical Formula (Hill Notation): C8H24O4Si4
Molecular Weight: 296.62
EC Number: 209-136-7
MDL Number: MFCD00003269
Linear Formula: [-Si(CH3)2O-]4
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 43883-100MG
| application(s) | cleaning products cosmetics environmental food and beverages personal care |
| assay | ≥97.0% (GC) |
| bp | 175-176 °C (lit.) |
| density | 0.956 g/mL at 25 °C (lit.) |
| form | liquid |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C8H24O4Si4/c1-13(2)9-1 |
| InChI key | HMMGMWAXVFQUOA-UHFFFAOYSA |
| mp | 17-18 °C (lit.) |
| Quality Level | 100  |
| refractive index | n |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | C[Si]1(C)O[Si](C)(C)O[Si] |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable | |
| vapor density | 1 (vs air) |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Symbol |   GHS02,GHS08 |
| Signal word | Warning |
| Hazard statements | H226 - H361f - H413 |
| Precautionary statements | P201 - P202 - P210 - P233 - P273 - P308 + P313 |
| Hazard Codes | Xn |
| Risk Statements | 10-53-62 |
| Safety Statements | 36/37-46-51-61 |
| RIDADR | UN 1993C 3 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 123.8 °F - closed cup |
| Flash Point(C) | 51 °C - closed cup |
| Purity | ≥97.0% (GC) |
| bp | 175-176 °C (lit.) |
| mp | 17-18 °C (lit.) |
| Density | 0.956 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 77101502 |