Dodecyltrimethylammonium hydrogen sulfate
SIAL/44243 - suitable for ion pair chromatography, LiChropur™, ≥99.0% (T)
CAS Number: 103999-25-3
Empirical Formula (Hill Notation): C15H35NO4S
Molecular Weight: 325.51
MDL Number: MFCD01863032
Linear Formula: CH3(CH2)11N(CH3)3HSO4
Product Type: Chemical
| λ | 10 % in H2O |
| assay | ≥99.0% (T) |
| description | anionic |
| form | solid |
| InChI | 1S/C15H34N.H2O4S/c1-5-6-7 |
| InChI key | KSZDKSNRUYOJHR-UHFFFAOYSA |
| quality | LiChropur™ |
| Quality Level | 100 ![]() |
| SMILES string | OS([O-])(=O)=O.CCCCCCCCCC |
| suitability | corresponds to standard for filter test |
| technique(s) | ion pair chromatography: suitable |
| UV absorption | λ: 210 nm Amax: 0.1 |
| λ: 240 nm Amax: 0.06 | |
| λ: 280 nm Amax: 0.04 | |
| λ: 310 nm Amax: 0.02 | |
| λ: 500 nm Amax: 0.02 |
| Legal Information: | LiChropur is a trademark of Merck KGaA, Darmstadt, Germany |
| Other Notes: | Discover LiChropur™ reagents ideal for HPLC or LC-MS analysis |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.0% (T) |
| UNSPSC | 41116105 |


