Methyl elaidate
SIAL/45119 - analytical standard
Synonym: Elaidic acid methyl ester; Methyl trans-9-octadecenoate
CAS Number: 1937-62-8
Empirical Formula (Hill Notation): C19H36O2
Molecular Weight: 296.49
EC Number: 217-712-4
MDL Number: MFCD00066521
Linear Formula: CH3(CH2)7CH=CH(CH2)7COOCH3
Product Type: Chemical
| assay | ≥99.0% (GC) |
| density | 0.871 g/mL at 20 °C (lit.) |
| format | neat |
| functional group | ester |
| grade | analytical standard |
| InChI | 1S/C19H36O2/c1-3-4-5-6-7- |
| InChI key | QYDYPVFESGNLHU-ZHACJKMWSA |
| mp | 9-10 °C |
| Quality Level | 100  |
| refractive index | n |
| shelf life | limited shelf life, expiry date on the label |
| shipped in | ambient |
| SMILES string | CCCCCCCCC=CCCCCCCCC(=O) |
| storage temp. | 2-8°C |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.0% (GC) |
| mp | 9-10 °C |
| Density | 0.871 g/mL at 20 °C (lit.) |
| Refractive Index | n |
| Storage Temp. | 2-8°C |
| UNSPSC | 85151701 |