Dichlorprop
SIAL/45436 - PESTANAL®, analytical standard
Synonym: 2-
CAS Number: 120-36-5
Empirical Formula (Hill Notation): C9H8Cl2O3
Molecular Weight: 235.06
EC Number: 204-390-5
MDL Number: MFCD00002645
Linear Formula: C9H8Cl2O3
Product Type: Chemical
| application(s) | agriculture environmental |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C9H8Cl2O3/c1-5(9(12)13 |
| InChI key | MZHCENGPTKEIGP-UHFFFAOYSA |
| product line | PESTANAL® |
| quality | racemate |
| Quality Level | 100 ![]() |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | CC(Oc1ccc(Cl)cc1Cl)C(O)=O |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Legal Information: | PESTANAL is a registered trademark of Merck KGaA, Darmstadt, Germany |
| Symbol | ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302 - H312 - H315 - H318 |
| Precautionary statements | P280 - P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Statements | 21/22-38-41 |
| Safety Statements | 26-36/37 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 2 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| UNSPSC | 41116107 |



