Ethofumesate
SIAL/45479 - PESTANAL®, analytical standard
CAS Number: 26225-79-6
Empirical Formula (Hill Notation): C13H18O5S
Molecular Weight: 286.34
EC Number: 247-525-3
MDL Number: MFCD00055321
Linear Formula: C13H18O5S
Product Type: Chemical
| application(s) | agriculture environmental |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C13H18O5S/c1-5-16-12-1 |
| InChI key | IRCMYGHHKLLGHV-UHFFFAOYSA |
| product line | PESTANAL® |
| Quality Level | 100 ![]() |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | CCOC1Oc2ccc(OS(C)(=O)=O)c |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Legal Information: | PESTANAL is a registered trademark of Merck KGaA, Darmstadt, Germany |
| Symbol | ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302 + H312 - H411 |
| Precautionary statements | P264 - P270 - P273 - P280 - P301 + P312 - P302 + P352 + P312 |
| Hazard Codes | N |
| Risk Statements | 51/53 |
| Safety Statements | 61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 212.0 °F - closed cup |
| Flash Point(C) | 100 °C - closed cup |
| UNSPSC | 41116107 |



