Methiocarb sulfone
SIAL/45729 - PESTANAL®, analytical standard
Synonym: Mercaptodimethursulfon; Methiocarb sulfone
CAS Number: 2179-25-1
Empirical Formula (Hill Notation): C11H15NO4S
Molecular Weight: 257.31
MDL Number: MFCD00144741
Linear Formula: C11H15NO4S
Product Type: Chemical
| application(s) | agriculture environmental |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C11H15NO4S/c1-7-5-9(16 |
| InChI key | RJBJMKAMQIOAML-UHFFFAOYSA |
| product line | PESTANAL® |
| Quality Level | 100 ![]() |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | CNC(=O)Oc1cc(C)c(c(C)c1)S |
| storage temp. | 2-8°C |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Legal Information: | PESTANAL is a registered trademark of Merck KGaA, Darmstadt, Germany |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Storage Temp. | 2-8°C |
| UNSPSC | 41116107 |


