Geranyl acetate
SIAL/45896 - analytical standard
Synonym: trans-
CAS Number: 105-87-3
Empirical Formula (Hill Notation): C12H20O2
Molecular Weight: 196.29
MDL Number: MFCD00015037
Linear Formula: CH3CO2CH2CH=C(CH3)CH2CH2CH=C(CH3)2
Product Type: Chemical
| application(s) | agriculture cleaning products cosmetics environmental flavors and fragrances food and beverages personal care |
| assay | ≥99.0% (GC) |
| bp | 138 °C/25 mmHg (lit.) |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C12H20O2/c1-10(2)6-5-7 |
| InChI key | HIGQPQRQIQDZMP-DHZHZOJOSA |
| Quality Level | 100  |
| refractive index | n |
| n |
|
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | CC(=O)OCC=C(/C)CCC=C(/C |
| storage temp. | 2-8°C |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable | |
| vapor density | 6.8 (vs air) |
| vapor pressure | 0.07 mmHg ( 20 °C) |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H317 - H412 |
| Precautionary statements | P273 - P280 - P302 + P352 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Flash Point(F) | 219.2 °F - closed cup |
| Flash Point(C) | 104 °C - closed cup |
| Purity | ≥99.0% (GC) |
| bp | 138 °C/25 mmHg (lit.) |
| Refractive Index | n |
| Storage Temp. | 2-8°C |
| UNSPSC | 85151701 |