Thifensulfuron-methyl
SIAL/46028 - PESTANAL®, analytical standard
Synonym: Harmony
CAS Number: 79277-27-3
Empirical Formula (Hill Notation): C12H13N5O6S2
Molecular Weight: 387.39
MDL Number: MFCD00468118
Linear Formula: C12H13N5O6S2
Product Type: Chemical
| application(s) | agriculture environmental |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C12H13N5O6S2/c1-6-13-1 |
| InChI key | AHTPATJNIAFOLR-UHFFFAOYSA |
| product line | PESTANAL® |
| Quality Level | 100  |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | COC(=O)c1sccc1S(=O)(=O)NC |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Application: | Thifensulfuron-methyl may be used as an analytical reference standard for the quantification of the analyte in environmental matrices using various chromatography techniques. |
| General description: | Thifensulfuron-methyl belongs to the class of sulfonylurea pesticides, generally employed for controlling many grasses and broadleaved weed species, affecting cultivation of crops such as corn, potatoes, tomatoes, citrus, vines and rice. |
| Legal Information: | PESTANAL is a registered trademark of Merck KGaA, Darmstadt, Germany |
| Symbol |  GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273 - P391 - P501 |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 2 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| UNSPSC | 41116107 |