Synonym: 4,6-Dimethylsulfadiazine; 4-Amino-N-(4,6-dimethyl-2-pyrimidinyl)benzenesulfonamide; Sulfadimethyldiazine; Sulfadimidine
CAS Number: 57-68-1
Empirical Formula (Hill Notation): C12H14N4O2S
Molecular Weight: 278.33
EC Number: 200-346-4
MDL Number: MFCD00006066
Linear Formula: C12H14N4O2S
Product Type: Chemical
| agency |
EPA 1694 |
| antibiotic activity spectrum |
Gram-negative bacteria |
| |
Gram-positive bacteria |
| application(s) |
clinical testing |
| format |
neat |
| grade |
analytical standard |
| InChI |
1S/C12H14N4O2S/c1-8-7-9(2)15-12(14-8)16-19(17,18)11-5-3-10(13)4-6-11/h3-7H,13H2,1-2H3,(H,14,15,16) |
| InChI key |
ASWVTGNCAZCNNR-UHFFFAOYSA-N |
| mode of action |
DNA synthesis | interferes |
| |
enzyme | inhibits |
| product line |
VETRANAL® |
| Quality Level |
200  |
| shelf life |
limited shelf life, expiry date on the label |
| SMILES string |
Cc1cc(C)nc(NS(=O)(=O)c2ccc(N)cc2)n1 |
| technique(s) |
gas chromatography (GC): suitable |
| |
HPLC: suitable |
| Application: |
Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Biochem/physiol Actions: |
An antimicrobial sulfur drug. Induces CYP3A4 expression and acetylated by N-acetyltransferase. Exhibits sex dependent pharmacokinetics, metabolized by the male specific isoform CYP2C11. |
| General description: |
Chemical structure: sulfonamide |
| Legal Information: |
VETRANAL is a registered trademark of Merck KGaA, Darmstadt, Germany |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 2 |
