Giemsa Stain, Modified Solution
SIAL/48900 - (for the staining (of cellular blood components and blood parasites))
Synonym: Azure eosin methylene blue; Giemsa solution
CAS Number: 51811-82-6
EC Number: 200-659-6
MDL Number: MFCD00081642
Product Type: Chemical
| InChI | 1S/C14H13N3S.ClH/c1-17(2) |
| InChI key | NALREUIWICQLPS-UHFFFAOYSA |
| Quality Level | 200  |
| shelf life | limited shelf life |
| SMILES string | [Cl-].CN(C)c1ccc2N=C3C=CC |
| suitability | Chlamydia spp. |
| Histoplasma spp. | |
| Plasmodium spp. | |
| Trichomonas spp. | |
| bacteria | |
| protozoa | |
| spirochetes | |
| technique(s) | microbe id | staining: suitable |
| type | (for research use only) |
| Application: | Tested for staining blood smears according to G. Clark (ed.), Staining Procedures, 4th edition, Williams & Wilkins, 173 (1981); together with May-Grünwald Solution for pap staining according to Pappenheim. |
| Caution: | store at 20°C |
| Physical form: | Solution of azure B/azure II-eosin/methylene blue 1:12:2 (w/w/w) in glycerol/methanol 5:24 (v/v); total dye content: 0.6 % (w/w) |
| Principle: | When blood films are stained using Giemsa Stain, the nucleus and cytoplasm of white blood cells take on characteristic blue or pink coloration. The use of purified eosin and thiazine dyes minimizes lot-to-lot variation. |
| Reconstitution: | Fix 10 min. in methanol; air-dry; immerse 45 min. in Giemsa Solution; rinse with distilled water; air-dry |
| Symbol |    GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225 - H301 + H311 + H331 - H370 |
| Precautionary statements | P210 - P233 - P280 - P301 + P310 - P303 + P361 + P353 - P304 + P340 + P311 |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 7-16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | WGK 2 |
| Flash Point(F) | 53.6 °F |
| Flash Point(C) | 12 °C |
| UNSPSC | 41116121 |