Linalyl acetate
SIAL/49599 - analytical standard
Synonym: 3,7-
CAS Number: 115-95-7
Empirical Formula (Hill Notation): C12H20O2
Molecular Weight: 196.29
EC Number: 204-116-4
MDL Number: MFCD00008907
Linear Formula: CH3CO2C(CH=CH2)(CH3)CH2CH2CH=C(CH3)2
Product Type: Chemical
| application(s) | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| assay | ≥97.0% (GC) |
| bp | 220 °C (lit.) |
| density | 0.901 g/mL at 25 °C (lit.) |
| 1.448-1.452 at 20 °C | |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C12H20O2/c1-6-12(5,14- |
| InChI key | UWKAYLJWKGQEPM-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| refractive index | n |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | CC(C)=CCCC(C)(OC(C)=O)C |
| storage temp. | 2-8°C |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable | |
| vapor density | 6.8 (vs air) |
| vapor pressure | 0.1 mmHg ( 20 °C) |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H317 - H319 |
| Precautionary statements | P261 - P264 - P272 - P280 - P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | WGK 1 |
| Flash Point(F) | 201.2 °F - closed cup |
| Flash Point(C) | 94 °C - closed cup |
| Purity | ≥97.0% (GC) |
| bp | 220 °C (lit.) |
| Density | 1.448-1.452 at 20 °C; 0.901 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| Storage Temp. | 2-8°C |
| UNSPSC | 85151701 |


