(3-Glycidyloxypropyl)triethoxysilane
SIAL/50059 - ≥97.0% (GC)
Synonym: GPTES; 3-
CAS Number: 2602-34-8
Empirical Formula (Hill Notation): C12H26O5Si
Molecular Weight: 278.42
EC Number: 220-011-6
MDL Number: MFCD01311705
Linear Formula: C12H26O5Si
Product Type: Chemical
| assay | ≥97.0% (GC) |
| density | 1.004 g/mL at 20 °C (lit.) |
| functional group | ether |
| InChI | 1S/C12H26O5Si/c1-4-15-18( |
| InChI key | JXUKBNICSRJFAP-UHFFFAOYSA |
| Quality Level | 100  |
| refractive index | n |
| SMILES string | CCO[Si](CCCOCC1CO1)(OCC)O |
| Application: | (3-Glycidyloxypropyl)trie • Polymer nanocomposite membranes for direct methanol fuel cells (DMFCs). • Azido terminated poly(ethylene glycol) silane that can be self-assembled on a metal-oxide surface to facilitate the orthogonal biofunctionalization. • Epoxy functionalized silsesquioxane nanoparticles (SQ-NPs). • Epoxy-functionalized mesoporous cellular foams (G-MCFs) as the support for the immobilization of penicillin G acylase (PGA). GPTES can also be used as a precursor to prepare water-repellent, self-cleaning coatings. |
| Packaging: | 50 mL in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H332 - H335 |
| Precautionary statements | P302 + P352 - P304 + P340 + P312 - P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Statements | 20-36/37/38 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | 291.2 °F |
| Flash Point(C) | 144 °C |
| Purity | ≥97.0% (GC) |
| Density | 1.004 g/mL at 20 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352103 |