HEPES buffered saline
SIAL/51558 - BioUltra, Molecular Biology, 2× concentrate
Synonym: HEPES Saline Buffer Solution
MDL Number: MFCD00006158
Product Type: Chemical
| λ | neat |
| cation traces | Al: ≤1 mg/kg |
| Ba: ≤1 mg/kg | |
| Bi: ≤1 mg/kg | |
| Ca: ≤5 mg/kg | |
| Cd: ≤1 mg/kg | |
| Co: ≤1 mg/kg | |
| Cr: ≤1 mg/kg | |
| Cu: ≤1 mg/kg | |
| Fe: ≤1 mg/kg | |
| Li: ≤1 mg/kg | |
| Mg: ≤1 mg/kg | |
| Mn: ≤1 mg/kg | |
| Mo: ≤1 mg/kg | |
| Ni: ≤1 mg/kg | |
| Pb: ≤1 mg/kg | |
| Sr: ≤1 mg/kg | |
| Zn: ≤1 mg/kg | |
| composition | dextrose, 2.0 g/L |
| HEPES, 10 g/L | |
| KCl, 0.74 g/L | |
| Na2HPO4.2H2O, 0.27 g/L | |
| NaCl, 16 g/L | |
| concentration | 2 × |
| form | liquid |
| grade | Molecular Biology |
| impurities | DNases, none detected |
| phosphatases, none detected | |
| proteases, none detected | |
| RNases, none detected | |
| InChI | 1S/C8H18N2O4S/c11-7-5-9-1 |
| InChI key | JKMHFZQWWAIEOD-UHFFFAOYSA |
| pH | 7.2 (25 °C) |
| product line | BioUltra |
| quality | 2× concentrate |
| Quality Level | 200  |
| refractive index | n |
| SMILES string | OCCN1CCN(CC1)CCS(O)(=O)=O |
| UV absorption | λ: 260 nm Amax: 0.06 |
| λ: 280 nm Amax: 0.04 |
| Application: | HEPES buffered saline has been used: • for the preparation of plasmid DNA • as a reagent to prepare transfection master mix for DNA construct vectors • to develop hydrogel precursor for cell leakage assay |
| General description: | HEPES buffered saline is a tissue culture buffer, which is used to maintain the pH of cell culture. It is water soluble and atmosphere independent. HEPES destroys magnesium in sodium chloride solutions. |
| Preparation Note: | concentration (in H2O): 10 g/l HEPES; 16 g/l NaCl; 0.74 g/l KCl; 0.27 g/l Na2HPO4.2H2O; 2.0 g/l dextrose |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Refractive Index | n |
| UNSPSC | 12161700 |