Hexadecyltrimethylammonium bisulfate
SIAL/52371 - suitable for ion pair chromatography, LiChropur™, ≥99.0% (T)
Synonym: Hexadecyltrimethylammonium hydrogen sulfate
CAS Number: 68214-07-3
Empirical Formula (Hill Notation): C19H43NO4S
Molecular Weight: 381.61
EC Number: 269-286-4
MDL Number: MFCD00134393
Linear Formula: CH3(CH2)15N(HSO4)(CH3)3
Product Type: Chemical
| λ | 10 % in H2O |
| assay | ≥99.0% (T) |
| description | cationic |
| form | solid |
| InChI | 1S/C19H42N.H2O4S/c1-5-6-7 |
| InChI key | UCRJJNVFJGKYQT-UHFFFAOYSA |
| quality | LiChropur™ |
| Quality Level | 100 ![]() |
| SMILES string | OS([O-])(=O)=O.CCCCCCCCCC |
| suitability | corresponds to standard for filter test |
| corresponds to standard for RP gradient test | |
| technique(s) | ion pair chromatography: suitable |
| UV absorption | λ: 210 nm Amax: 0.15 |
| λ: 220 nm Amax: 0.10 | |
| λ: 260 nm Amax: 0.05 | |
| λ: 310 nm Amax: 0.02 | |
| λ: 500 nm Amax: 0.02 |
| Application: | Hexadecyltrimethylammoniu |
| General description: | Hexadecyltrimethylammoniu |
| Legal Information: | LiChropur is a trademark of Merck KGaA, Darmstadt, Germany |
| Other Notes: | Discover LiChropur™ reagents ideal for HPLC or LC-MS analysis |
| Packaging: | 5 g in glass bottle |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.0% (T) |
| UNSPSC | 23151817 |

