Synonym: 8-β-D-Glucopyranosyl-3′,4′,5,7-tetrahydroxyflavone; Luteolin 8-C-β-D-glucopyranoside; Luteolin-8-glucoside; Lutexin
CAS Number: 28608-75-5
Empirical Formula (Hill Notation): C21H20O11
Molecular Weight: 448.38
MDL Number: MFCD00017432
Linear Formula: C21H20O11
Product Type: Chemical
| application(s) |
food and beverages |
| assay |
≥98.0% (HPLC) |
| format |
neat |
| grade |
analytical standard |
| impurities |
≤5.0% water |
| InChI |
1S/C21H20O11/c22-6-14-17(28)18(29)19(30)21(32-14)16-11(26)4-10(25)15-12(27)5-13(31-20(15)16)7-1-2-8(23)9(24)3-7/h1-5,14,17-19,21-26,28-30H,6H2/t14-,17-,18+,19-,21+/m1/s1 |
| InChI key |
PLAPMLGJVGLZOV-VPRICQMDSA-N |
| Quality Level |
100  |
| shelf life |
limited shelf life, expiry date on the label |
| SMILES string |
OC[C@H]1O[C@H]([C@H](O)[C@@H](O)[C@@H]1O)c2c(O)cc(O)c3C(=O)C=C(Oc23)c4ccc(O)c(O)c4 |
| technique(s) |
gas chromatography (GC): suitable |
| |
HPLC: suitable |
| Application: |
Orientin may be used as an analytical reference standard for the quantification of the analyte in leaves of Cecropia species and biological samples using various chromatography techniques. |
| Application: |
Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Biochem/physiol Actions: |
Flavonoid glycoside found in the acai tree and globe and passion flowers. Antiviral, antimicrobial and antioxidant. Exhibits radioprotective activities. |
| General description: |
Orientin is a flavone existing in a variety of plants and exhibits a broad-spectrum of pharmacological properties such as free-radical inhibition, antiviral, radioprotection, anti-oxidant and vasorelaxant property. |
| Packaging: |
Bottomless glass bottle. Contents are inside inserted fused cone. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98.0% (HPLC) |
| UNSPSC |
85151701 |
