Synonym: 1,2,3,4,5,6-Hexahydroxycyclohexane, i-Inositol, meso-Inositol; 1,2,3,4,5,6-Hexahydroxycyclohexane; i-Inositol; meso-Inositol
CAS Number: 87-89-8
Empirical Formula (Hill Notation): C6H12O6
Molecular Weight: 180.16
EC Number: 201-781-2
MDL Number: MFCD00077932
Linear Formula: C6H12O6
Product Type: Chemical
| anion traces |
chloride (Cl-): ≤50 mg/kg |
| |
sulfate (SO42-): ≤50 mg/kg |
| application(s) |
microbiology |
| assay |
≥99.0% |
| |
≥99.0% (HPLC) |
| cation traces |
As: ≤0.1 mg/kg |
| |
Ca: ≤10 mg/kg |
| |
Cd: ≤5 mg/kg |
| |
Co: ≤5 mg/kg |
| |
Cr: ≤5 mg/kg |
| |
Cu: ≤5 mg/kg |
| |
Fe: ≤5 mg/kg |
| |
K: ≤50 mg/kg |
| |
Mg: ≤5 mg/kg |
| |
Mn: ≤5 mg/kg |
| |
Na: ≤50 mg/kg |
| |
Ni: ≤5 mg/kg |
| |
Pb: ≤5 mg/kg |
| |
Zn: ≤5 mg/kg |
| form |
powder |
| ign. residue |
≤0.2% (as SO4) |
| InChI |
1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3-,4+,5-,6- |
| InChI key |
CDAISMWEOUEBRE-GPIVLXJGSA-N |
| loss |
≤0.5% loss on drying, 110 °C |
| mp |
222-227 °C (lit.) |
| packaging |
pkg of 100 g |
| |
pkg of 25 g |
| |
pkg of 500 g |
| Quality Level |
200  |
| SMILES string |
O[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| solubility |
H2O: 0.1 g/mL, clear |
| vapor density |
6.2 (vs air) |
| Application: |
Myo-inositol is used as a carbon source for the cultivation of various of bacteria, fungi and yeasts in many industries such as food, pharmaceuticals and cosmetics |
| Biochem/physiol Actions: |
A component of membrane phospholipids, glycosylphosphatidylinositol anchors that bind glycoproteins to cell membranes, and inositol phosphate second messengers. |
| General description: |
Myo-inositol (stereoisomer of inositol), a water-soluble six-carbon ring compound, required for growth various of bacteria, fungi and yeasts. Inositol is also a precursor of various biofunctional compounds containing inositol phosphate and lipid. It is a component of membrane phospholipids, glycosylphosphatidylinositol anchors that bind glycoproteins to cell membranes, and inositol phosphate second messengers. Myo-inositol plays an important role in cell morphogenesis and cytogenesis, lipid synthesis, structure of cell membranes and cell growth. Various bacteria can grow on Myo-inositol as the sole carbon source. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 2 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥99.0% (HPLC); ≥99.0% |
| mp |
222-227 °C (lit.) |
| UNSPSC |
41106212 |
