N-Lauroylsarcosine
SIAL/61739 - purum p.a., ≥98.0% (GC)
Synonym: N-Dodecanoyl-N-methylglycine; Sarkosyl L
CAS Number: 97-78-9
Empirical Formula (Hill Notation): C15H29NO3
Molecular Weight: 271.40
EC Number: 202-608-3
MDL Number: MFCD00021749
Linear Formula: CH3(CH2)10CON(CH3)CH2COOH
Product Type: Chemical
| anion traces | chloride (Cl-): ≤50 mg/kg |
| sulfate (SO42-): ≤100 mg/kg | |
| assay | ≥98.0% (GC) |
| cation traces | Ca: ≤20 mg/kg |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤10 mg/kg | |
| K: ≤70 mg/kg | |
| Mg: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Na: ≤200 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Zn: ≤20 mg/kg | |
| description | anionic |
| grade | purum p.a. |
| ign. residue | ≤0.1% |
| impurities | ≤0.2% water |
| InChI | 1S/C15H29NO3/c1-3-4-5-6-7 |
| InChI key | BACYUWVYYTXETD-UHFFFAOYSA |
| mol wt | 271.40 g/mol |
| mp | 45-50 °C |
| Quality Level | 200  |
| SMILES string | CCCCCCCCCCCC(=O)N(C)CC(O) |
| technique(s) | protein quantification: suitable |
| Application: | N-Lauroylsarcosine may be used as a permeation enhancer in the transdermal drug delivery formulations since it increases the fluidity of stratum corneum lipid structure of the skin† |
| General description: | N-Lauroylsarcosine (N-Dodecanoyl-N-methylglycine, Sarkosyl L, LS) is an anionic surfactant. Its microbicidal action against herpes simplex type 2 (HSV-2) intravaginal infection in a murine model has been investigated. |
| Symbol |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H315 - H318 - H330 |
| Precautionary statements | P280 - P302 + P352 - P304 + P340 + P310 - P305 + P351 + P338 + P310 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 2811 6.1 / PGII |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98.0% (GC) |
| mp | 45-50 °C |
| UNSPSC | 12352100 |