L-Lysine monohydrochloride
SIAL/62929 - BioUltra, ≥99.5% (AT)
Synonym: (S)-2,6-Diaminohexanoic acid monohydrochloride
CAS Number: 657-27-2
Empirical Formula (Hill Notation): C6H14N2O2 · HCl
Molecular Weight: 182.65
EC Number: 211-519-9
MDL Number: MFCD00064564
Linear Formula: H2N(CH2)4CH(NH2)CO2H·HCl
Product Type: Chemical
| λ | 0.5 M in H2O |
| anion traces | sulfate (SO42-): ≤100 mg/kg |
| assay | ≥99.5% (AT) |
| cation traces | Al: ≤5 mg/kg |
| As: ≤0.1 mg/kg | |
| Ba: ≤5 mg/kg | |
| Bi: ≤5 mg/kg | |
| Ca: ≤10 mg/kg | |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤5 mg/kg | |
| K: ≤50 mg/kg | |
| Li: ≤5 mg/kg | |
| Mg: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Mo: ≤5 mg/kg | |
| Na: ≤50 mg/kg | |
| NH4+: ≤100 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Sr: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| color | white |
| form | powder or crystals |
| ign. residue | ≤0.1% (as SO4) |
| impurities | insoluble matter, passes filter test |
| ≤0.3% foreign amino acids | |
| InChI | 1S/C6H14N2O2.ClH/c7-4-2-1 |
| InChI key | BVHLGVCQOALMSV-JEDNCBNOSA |
| loss | ≤0.5% loss on drying, 20 °C (HV) |
| mp | 263 °C (dec.) (lit.) |
| optical activity | [α]20/D +20.5±0.5°, c = 5% in 5 M HCl |
| pH | 5.0-6.0 (25 °C, 0.5 M in H2O) |
| product line | BioUltra |
| Quality Level | 200  |
| SMILES string | OC([C@@H](N)CCCCN)=O.[H]C |
| solubility | H2O: 0.5 M at 20 °C, clear, colorless |
| technique(s) | cell culture | mammalian: suitable |
| UV absorption | λ: 260 nm Amax: 0.1 |
| λ: 280 nm Amax: 0.1 |
| Application: | L-Lysine monohydrochloride has been used: • to study its effect on mRNA decay and destruction using mammalian cells • to determine its effec on aTC1-6 cell proliferation • to study the dynamics of the phosphoproteome upon amino acid supplement removal in the growth medium |
| Biochem/physiol Actions: | L-Lysine is associated with a number of biochemical reactions such as acetylation, O-linked glycosylation, ubiquitination and protein methylation. Lysine participates in the regulation of NO (nitric oxide) synthesis. It possesses antiviral activity, therefore it is used in the treatment of Herpes simplex. L-Lysine is believed to prevent osteoporosis of bones, which is a characteristic of vascular calcification. Glutaric aciduria type I and pyridoxine-dependent epilepsy occurs due to lack of L-lysine catabolic pathway. Hydroxylysine is a component of collagen |
| General description: | L-Lysine is an essential amino acid, not generated by the body, instead must be supplemented through food. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.5% (AT) |
| mp | 263 °C (dec.) (lit.) |
| UNSPSC | 12352209 |