6-Maleimidohexanoic acid N-hydroxysuccinimide ester
SIAL/63177 - ≥98.0% (HPLC)
Synonym: 6-Maleimidocaproic acid N-succinimidyl ester; N-(ε-Maleimidocaproyloxy)succinimide; N-Succinimidyl 6-maleimidocaproate; EMCS
CAS Number: 55750-63-5
Empirical Formula (Hill Notation): C14H16N2O6
Molecular Weight: 308.29
MDL Number: MFCD00043043
Linear Formula: C14H16N2O6
Product Type: Chemical
| assay | ≥98.0% (HPLC) |
| form | solid |
| functional group | NHS ester |
| InChI | 1S/C14H16N2O6/c17-10-5-6- |
| InChI key | VLARLSIGSPVYHX-UHFFFAOYSA |
| mp | 67-73 °C |
| 70-73 °C (lit.) | |
| Quality Level | 200  |
| reaction suitability | reagent type: linker |
| SMILES string | O=C(ON(C(CC1)=O)C1=O)CCCC |
| storage temp. | −20°C |
| Application: | 6-Maleimidohexanoic acid N-hydroxysuccinimide ester is a heterobifunctional cross-linking reagent with amine and sulfhydryl reactivity. Typically, coupled initially to molecules containing primary amines by amide bonds buffered at pH 7.5 (6.5-8.5). Second coupling specific for molecules containing free sulfhydryl by thioether linkage buffered at pH 6.8 (6.5-7.0). Useful for preparation of enzyme immunoconjugates and hapten carrier molecule conjugates. |
| Other Notes: | Reagent for cross-linking and immobilisation of proteins |
| Packaging: | Bottomless glass bottle. Contents are inside inserted fused cone. |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98.0% (HPLC) |
| mp | 67-73 °C; 70-73 °C (lit.) |
| Storage Temp. | −20°C |
| UNSPSC | 12352106 |