D-Mannitol
SIAL/63560 - ACS reagent, suitable for microbiology, ≥99.0%
Synonym: Mannite
CAS Number: 69-65-8
Empirical Formula (Hill Notation): C6H14O6
Molecular Weight: 182.17
EC Number: 200-711-8
MDL Number: MFCD00064287
Linear Formula: C6H14O6
Product Type: Chemical
anion traces | chloride (Cl-): ≤50 mg/kg |
sulfate (SO42-): ≤50 mg/kg | |
application(s) | microbiology |
assay | ≥99.0% |
≥99.0% (sum of enantiomers, HPLC) | |
cation traces | As: ≤0.1 mg/kg |
Ca: ≤10 mg/kg | |
Cd: ≤5 mg/kg | |
Co: ≤5 mg/kg | |
Cr: ≤5 mg/kg | |
Cu: ≤5 mg/kg | |
Fe: ≤5 mg/kg | |
heavy metals: ≤5 ppm (by ICP-OES) | |
K: ≤50 mg/kg | |
Mg: ≤5 mg/kg | |
Mn: ≤5 mg/kg | |
Na: ≤50 mg/kg | |
Ni: ≤5 mg/kg | |
Pb: ≤5 mg/kg | |
Zn: ≤5 mg/kg | |
form | powder |
grade | ACS reagent |
ign. residue | ≤0.01% (as SO4) |
InChI | 1S/C6H14O6/c7-1-3(9)5(11) |
InChI key | FBPFZTCFMRRESA-KVTDHHQDSA |
loss | ≤0.05% loss on drying, 20 °C (HV) |
mp | 165-169 °C |
167-170 °C (lit.) | |
optical activity | [α]20/D +24.0±1° in borax solution acc. to ACS |
Quality Level | 200 |
SMILES string | OC[C@@H](O)[C@@H](O)[C@H] |
solubility | H2O: 0.1 g/mL, clear, colorless |
Application: | |
Biochem/physiol Actions: | |
Biochem/physiol Actions: | A sugar alcohol sweet tastant. Used in sweetness inhibition studies. |
General description: | |
Other Notes: | Important starting material for the synthesis of many chiral building blocks. |
RIDADR | NONH for all modes of transport |
WGK Germany | WGK 1 |
Purity | ≥99.0% (sum of enantiomers, HPLC); ≥99.0% |
mp | 165-169 °C; 167-170 °C (lit.) |
UNSPSC | 41106212 |