Synonym: Melezitose monohydrate, D-(+)-Melicitose monohydrate, α-D-(+)-Melicitose monohydrate, D-(+)-alpha-Melicitose monohydrate, D-(+)-3-O-α-D-Glucopyranosyl-D-glucose monohydrate; O-α-D-Glucopyranosyl-(1→3)-β-D-fructofuranosyl-α-D-glucopyranoside
CAS Number: 10030-67-8
Empirical Formula (Hill Notation): C18H32O16 · H2O
Molecular Weight: 522.45
EC Number: 209-894-9
MDL Number: MFCD00149448
Linear Formula: C18H32O16 · H2O
Product Type: Chemical
| anion traces |
chloride (Cl-): ≤50 mg/kg |
| |
sulfate (SO42-): ≤500 mg/kg |
| application(s) |
microbiology |
| assay |
≥99.0% |
| |
≥99.0% (HPLC) |
| cation traces |
As: ≤0.1 mg/kg |
| |
Ca: ≤500 mg/kg |
| |
Cd: ≤5 mg/kg |
| |
Co: ≤5 mg/kg |
| |
Cr: ≤5 mg/kg |
| |
Cu: ≤5 mg/kg |
| |
Fe: ≤5 mg/kg |
| |
K: ≤50 mg/kg |
| |
Mg: ≤10 mg/kg |
| |
Mn: ≤5 mg/kg |
| |
Na: ≤50 mg/kg |
| |
Ni: ≤5 mg/kg |
| |
Pb: ≤5 mg/kg |
| |
Zn: ≤5 mg/kg |
| color |
colorless to white |
| form |
powder |
| ign. residue |
≤0.1% (as SO4) |
| InChI |
1S/C18H32O16.H2O/c19-1-5-8(23)11(26)13(28)16(30-5)32-15-10(25)7(3-21)33-18(15,4-22)34-17-14(29)12(27)9(24)6(2-20)31-17;/h5-17,19-29H,1-4H2;1H2/t5-,6-,7-,8-,9-,10-,11+,12+,13-,14-,15+,16-,17-,18+;/m1./s1 |
| InChI key |
CFXAVQUXSYFPDE-ZDVKUAOASA-N |
| mp |
154-160 °C (dec.) |
| optical activity |
[α]20/D +88±2°, c = 4% in H2O |
| packaging |
pkg of 10 g |
| |
pkg of 50 g |
| Quality Level |
200  |
| SMILES string |
O.OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@@H](O)[C@@H]1O |
| solubility |
H2O: 50 mg/mL, clear, colorless |
| storage condition |
(Keep container tightly closed in a dry and well-ventilated place. Air sensitive.) |
| Application: |
D-(+)-Melezitose monohydrate finds applications in various fields, including analytical chemistry, research and development, biochemical studies, and food industry. D-(+)-Melezitose can be used to identify clinical isolates of indole-positive and indole-negative Klebsiella spp. |
| General description: |
D-(+)-Melezitose monohydrate is a crystalline form of the trisaccharide compound known as melezitose. Melezitose is composed of three glucose molecules linked together in a specific arrangement. It is commonly found in certain plants, such as cotton and buckwheat, as well as in the honeydew produced by some insect species. This compound can be used in various applications, including as a reference standard in analytical chemistry or as a component in research and development studies. It is also used in biochemical studies for investigating the metabolism and enzymatic activities related to sugars and carbohydrates. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥99.0% (HPLC); ≥99.0% |
| mp |
154-160 °C (dec.) |
| UNSPSC |
41106212 |
