Synonym: Raffinose, Melizitose, α-D-Galactosyl-(1→6)-α-D-glucopyranoside, Galactosyl D-glucose, Galactosylglucose, D-Galactopyranosyl-(1→6)-D-glucose, Melibiose, Galactinol, D-(+)-Galactosyl-(1→6)-D-(+)-glucose, α-D-Gal(1→6)β-D-Glc; 6-O-α-D-Galactopyranosyl-D-glucose
CAS Number: 585-99-9
Empirical Formula (Hill Notation): C12H22O11
Molecular Weight: 342.30
EC Number: 209-568-6
MDL Number: MFCD00168065
Linear Formula: C12H22O11
Product Type: Chemical
| anion traces |
chloride (Cl-): ≤50 mg/kg |
| |
sulfate (SO42-): ≤200 mg/kg |
| application(s) |
microbiology |
| assay |
≥99.0% |
| |
≥99.0% (HPLC) |
| cation traces |
As: ≤0.1 mg/kg |
| |
Ca: ≤500 mg/kg |
| |
Cd: ≤5 mg/kg |
| |
Co: ≤5 mg/kg |
| |
Cr: ≤5 mg/kg |
| |
Cu: ≤5 mg/kg |
| |
Fe: ≤10 mg/kg |
| |
K: ≤50 mg/kg |
| |
Mg: ≤10 mg/kg |
| |
Mn: ≤5 mg/kg |
| |
Na: ≤50 mg/kg |
| |
Ni: ≤5 mg/kg |
| |
Pb: ≤5 mg/kg |
| |
Zn: ≤5 mg/kg |
| color |
colorless to white |
| form |
powder |
| ign. residue |
≤0.1% (as SO4) |
| InChI |
1S/C12H22O11/c13-1-4(15)7(17)8(18)5(16)3-22-12-11(21)10(20)9(19)6(2-14)23-12/h1,4-12,14-21H,2-3H2/t4-,5+,6+,7+,8+,9-,10-,11+,12-/m0/s1 |
| InChI key |
AYRXSINWFIIFAE-GFRRCQKTSA-N |
| optical activity |
[α]20/D +137±3°, 10 hr, c = 5% in H2O |
| packaging |
pkg of 10 g |
| |
pkg of 50 g |
| Quality Level |
200  |
| SMILES string |
OC[C@H]1O[C@H](OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O)[C@H](O)[C@@H](O)[C@H]1O |
| solubility |
H2O: 0.1 g/mL, clear, colorless |
| storage condition |
(Keep the container tightly closed in a dry and well-ventilated place.Hygroscopic, Store under inert gas.) |
| Application: |
D-(+)-Melibiose has applications in the fields of microbiology, research and development, and in food and pharmaceutical industries. Melibiose fermentation test is used to differentiate bacteria like Enterobacteriaceae (like Salmonella, E.coli, shigella, Citrobacter, Klebsiella, Enterobacter) and yeasts. It is also used for the differentiation between the plant pathogenic bacteria Klebsiella pneumoniae and K. variicola. |
| General description: |
D-(+)-Melibiose is a reducing disaccharide composed of a unit of galactose linked to a unit of glucose by a glycosidic bond α (1 → 6). It is commonly found in plants and the roots of certain legumes. D-(+)-Melibiose is not metabolized by humans but serves as a substrate for certain bacteria and fungi. It is used as a differential medium component in microbiological media to detect the fermentation of melibiose by microorganisms. It helps identify specific bacterial species based on their ability to ferment melibiose. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥99.0% (HPLC); ≥99.0% |
| UNSPSC |
41106212 |
