(−)-Menthone
SIAL/63677 - analytical standard
Synonym: (1R,4S)-p-Menthan-3-one; (2S,5R)
CAS Number: 14073-97-3
Empirical Formula (Hill Notation): C10H18O
Molecular Weight: 154.25
EC Number: 237-926-1
MDL Number: MFCD00001634
Linear Formula: C10H18O
Product Type: Chemical
| application(s) | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| assay | ≥98.5% (sum of enantiomers, GC) |
| bp | 207-210 °C (lit.) |
| density | 0.893 g/mL at 20 °C (lit.) |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C10H18O/c1-7(2)9-5-4-8 |
| InChI key | NFLGAXVYCFJBMK-BDAKNGLRSA |
| optical activity | [α]20/D −28±2°, neat |
| optical purity | enantiomeric ratio: ≥90:10 (GC) |
| Quality Level | 100  |
| refractive index | n |
| n |
|
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | CC(C)[C@@H]1CC[C@@H](C)CC |
| storage temp. | 2-8°C |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable | |
| vapor pressure | 0.5 mmHg ( 20 °C) |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Other Notes: | Highly purified (-)-menthone. Resolving agent for diols via acetalization ; Menthone-derived spirocyclic 1,3-dioxane-4,6-diones are used in asymmetric Diels-Alder and (2+2) cycloadditions |
| Other Notes: | This compound is commonly found in plants of the genus: mentha |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H317 |
| Precautionary statements | P280 - P302 + P352 |
| Hazard Codes | Xi |
| Risk Statements | 38-43 |
| Safety Statements | 36/37 |
| WGK Germany | WGK 1 |
| Flash Point(F) | 165.2 °F |
| Flash Point(C) | 74 °C |
| Purity | ≥98.5% (sum of enantiomers, GC) |
| bp | 207-210 °C (lit.) |
| Density | 0.893 g/mL at 20 °C (lit.) |
| Refractive Index | n |
| Storage Temp. | 2-8°C |
| UNSPSC | 85151701 |