Synonym: β-Elemene; (1S,2S,4R)-(−)-2,4-Diisopropenyl-1-methyl-1-vinylcyclohexane; (1S,2S,4R)-1-Ethenyl-1-methyl-2,4-bis(1-methylethenyl)cyclohexane
CAS Number: 515-13-9
Empirical Formula (Hill Notation): C15H24
Molecular Weight: 204.35
MDL Number: MFCD00468041
Linear Formula: C15H24
Product Type: Chemical
| application(s) |
food and beverages |
| assay |
≥98.0% (GC) |
| format |
neat |
| grade |
analytical standard |
| InChI |
1S/C15H24/c1-7-15(6)9-8-13(11(2)3)10-14(15)12(4)5/h7,13-14H,1-2,4,8-10H2,3,5-6H3/t13-,14+,15-/m1/s1 |
| InChI key |
OPFTUNCRGUEPRZ-QLFBSQMISA-N |
| Quality Level |
100  |
| shelf life |
limited shelf life, expiry date on the label |
| SMILES string |
C[C@@]1(C=C)CC[C@@H](C(C)=C)C[C@H]1C(C)=C |
| storage temp. |
2-8°C |
| technique(s) |
gas chromatography (GC): suitable |
| |
HPLC: suitable |
| Application: |
Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Other Notes: |
This compound is commonly found in plants of the genus: achillea |
| Risk Statements |
66 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
208.4 °F |
| Flash Point(C) |
98 °C |
| Supplemental Hazard Statements |
EUH066 |
| Purity |
≥98.0% (GC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
85151701 |
