N-Methyl-D-glucamine
SIAL/66930 - ReagentPlus®, ≥99.0% (T)
Synonym: 1-
CAS Number: 6284-40-8
Empirical Formula (Hill Notation): C7H17NO5
Molecular Weight: 195.21
EC Number: 228-506-9
MDL Number: MFCD00004707
Linear Formula: C7H17NO5
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material.
This image depicts SKU: 66930-100G
This image depicts SKU: 66930-100G
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material.
This image depicts SKU: 66930-500G
This image depicts SKU: 66930-500G
| anion traces | chloride (Cl-): ≤50 mg/kg |
| phosphate (PO43-): ≤5 mg/kg | |
| sulfate (SO42-): ≤50 mg/kg | |
| assay | ≥99.0% (T) |
| autoignition temp. | ~662 °F |
| biological source | synthetic |
| cation traces | Ca: ≤10 mg/kg |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤5 mg/kg | |
| K: ≤50 mg/kg | |
| Mg: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Mo: ≤5 mg/kg | |
| Na: ≤50 mg/kg | |
| Ni: ≤20 mg/kg | |
| Pb: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| form | powder |
| InChI | 1S/C7H17NO5/c1-8-2-4(10)6 |
| InChI key | MBBZMMPHUWSWHV-BDVNFPICSA |
| mp | 126-131 °C |
| 129-131.5 °C (lit.) | |
| optical activity | [α]20/D −16.5±0.5°, c = 2% in H2O |
| product line | ReagentPlus® |
| Quality Level | 200  |
| SMILES string | CNC[C@H](O)[C@@H](O)[C@H] |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| Application: | N-Methyl-D-glucamine is utilized as: • An ion exchange resin due to its high affinity and selectivity for specific ions • A buffering agent to remove boron from an aqueous solution |
| General description: | N-Methyl-D-glucamine, also known as Meglumine, is a sorbitol-derived amino sugar. It acts as a catalyst in one-pot synthesis of pyranopyrazole derivatives. |
| Legal Information: | ReagentPlus is a registered trademark of Merck KGaA, Darmstadt, Germany |
| Packaging: | 100, 500 g in poly bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.0% (T) |
| mp | 126-131 °C; 129-131.5 °C (lit.) |
| UNSPSC | 12352104 |