Synonym: (3β,6α,12β)-3,12-Dihydroxydammar-24-ene-6,20-diyl bis-β-D-glucopyranoside; Ginsenoside A2; Ginsenoside g1; Panaxoside A; Panaxoside Rg1; Sanchinoside C1; Sanchinoside Rg1
CAS Number: 22427-39-0
Empirical Formula (Hill Notation): C42H72O14
Molecular Weight: 801.01
EC Number: 244-989-9
MDL Number: MFCD00210293
Linear Formula: C42H72O14
Product Type: Chemical
| application(s) |
food and beverages |
| assay |
≥90% (HPLC) |
| format |
neat |
| grade |
analytical standard |
| InChI |
1S/C42H72O14/c1-20(2)10-9-13-42(8,56-37-34(52)32(50)30(48)25(19-44)55-37)21-11-15-40(6)28(21)22(45)16-26-39(5)14-12-27(46)38(3,4)35(39)23(17-41(26,40)7)53-36-33(51)31(49)29(47)24(18-43)54-36/h10,21-37,43-52H,9,11-19H2,1-8H3/t21-,22+,23-,24+,25+,26+,27-,28-,29+,30+,31-,32-,33+,34+,35-,36+,37-,39+,40+,41+,42-/m0/s1 |
| InChI key |
YURJSTAIMNSZAE-HHNZYBFYSA-N |
| Quality Level |
100  |
| shelf life |
limited shelf life, expiry date on the label |
| SMILES string |
CC(C)=C/CC[C@](C)(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@H]2CC[C@]3(C)[C@@H]2[C@H](O)C[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5[C@H](C[C@@]34C)O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O |
| technique(s) |
gas chromatography (GC): suitable |
| |
HPLC: suitable |
| Application: |
Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| General description: |
Ginsenoside Rg1 is a major component of the root and stem of ginseng plant. It possesses a broad spectrum of pharmacological properties like neuroprotection, anti-inflammation, anti-aging, anti-fatigue and memory-enhancing properties. |
| Symbol |
 GHS07 |
| Signal word |
Warning |
| Hazard statements |
H302 |
| Hazard Codes |
Xn |
| Risk Statements |
22 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥90% (HPLC) |
| UNSPSC |
85151701 |
