N-Methyl-N-trimethylsilylheptafluorobutyramide
SIAL/69484 - for GC derivatization, LiChropur™, ≥90% (GC)
Synonym: N-Trimethylsilyl-N-
CAS Number: 53296-64-3
Empirical Formula (Hill Notation): C8H12F7NOSi
Molecular Weight: 299.26
MDL Number: MFCD00077822
Linear Formula: CF3CF2CF2CON(CH3)Si(CH3)3
Product Type: Chemical
| assay | ≥90% (GC) |
| bp | 148 °C (lit.) |
| density | 1.254 g/mL at 25 °C (lit.) |
| form | liquid |
| grade | for GC derivatization |
| InChI | 1S/C8H12F7NOSi/c1-16(18(2 |
| InChI key | CMXKINNDZCNCEI-UHFFFAOYSA |
| quality | LiChropur™ |
| Quality Level | 100  |
| reaction suitability | reagent type: derivatization reagent reaction type: Silylations |
| refractive index | n |
| n |
|
| SMILES string | CN(C(=O)C(F)(F)C(F)(F)C(F |
| technique(s) | gas chromatography (GC): suitable |
| Legal Information: | LiChropur is a trademark of Merck KGaA, Darmstadt, Germany |
| Other Notes: | N-methyl-N-trimethylsilyl |
| Other Notes: | Silylating agent for use in GC-analyses. It interferes least with flame-ionization detectors |
| Packaging: | 1, 5 mL in glass bottle |
| Symbol |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226 - H315 - H319 - H335 |
| Precautionary statements | P210 - P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26 |
| RIDADR | UN 1993C 3 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 91.4 °F - closed cup |
| Flash Point(C) | 33 °C - closed cup |
| Purity | ≥90% (GC) |
| bp | 148 °C (lit.) |
| Density | 1.254 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12000000 |