Bergapten
SIAL/69664 - analytical standard
Synonym: 5-Methoxypsoralen; 4-Methoxyfuro[3,2-g]benzopyrane-7-one; Bergapten; Geralen; Heraclin; Majudin
CAS Number: 484-20-8
Empirical Formula (Hill Notation): C12H8O4
Molecular Weight: 216.19
EC Number: 207-604-5
MDL Number: MFCD00010272
Linear Formula: C12H8O4
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 69664-25MG
| application(s) | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| assay | ≥99.0% (HPLC) |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C12H8O4/c1-14-12-7-2-3 |
| InChI key | BGEBZHIAGXMEMV-UHFFFAOYSA |
| mp | 189-193 °C |
| 190-193 °C (lit.) | |
| Quality Level | 100  |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | COc1c2C=CC(=O)Oc2cc3occc1 |
| storage temp. | 2-8°C |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Packaging: | Bottomless glass bottle. Contents are inside inserted fused cone. |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P280 - P302 + P352 |
| Hazard Codes | T |
| Risk Statements | 45-43 |
| Safety Statements | 53-36/37-45 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.0% (HPLC) |
| mp | 189-193 °C; 190-193 °C (lit.) |
| Storage Temp. | 2-8°C |
| UNSPSC | 85151701 |