Monochlorobimane
SIAL/69899 - suitable for fluorescence, ≥70.0% (HPCE)
Synonym: mBCl; Chlorobimane
CAS Number: 76421-73-3
Empirical Formula (Hill Notation): C10H11ClN2O2
Molecular Weight: 226.66
MDL Number: MFCD00077379
Linear Formula: C10H11ClN2O2
Product Type: Chemical
| assay | ≥70.0% (HPCE) |
| fluorescence | λex 380 nm; λem 461 nm in methanol |
| λex 390 nm; λem 478 nm in 0.1 M phosphate pH 7.5 (after derivatization with glutathione) | |
| form | powder |
| InChI | 1S/C10H11ClN2O2/c1-5-7(3) |
| InChI key | SUIPVTCEECPFIB-UHFFFAOYSA |
| mp | 135-136 °C (lit.) |
| Quality Level | 100  |
| SMILES string | CC1=C(C)C(=O)N2N1C(CCl)=C |
| solubility | acetonitrile: soluble |
| DMF: soluble | |
| DMSO: soluble | |
| methanol: soluble | |
| suitability | suitable for fluorescence |
| Application: | Monochlorobimane is used as a fluorescent agent in fluorometric glutathione assays. It is used to detect the principal intracellular low-molecular-weight thiols, which play a pivotal role in the defense mechanism. |
| General description: | Monochlorobimane is a glutathione (GSH) fluorescent cell-permeable probe. When incubated with the test cell culture, it readily enters the cells and forms a fluorescent complex. The Monochlorobimane-GSH reaction is catalyzed by glutathione-S-transferase Monochlorobimane, also known as mBCl, is a non-fluorescent compound that forms a fluorescent complex upon reaction. The fluorescence is detected at 394/490nm. |
| Packaging: | Bottomless glass bottle. Contents are inside inserted fused cone. |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥70.0% (HPCE) |
| mp | 135-136 °C (lit.) |
| UNSPSC | 12352200 |