Synonym: 1,2-Naphthoquinone-4-sulfonic acid sodium salt; 3,4-Dihydro-3,4-dioxo-1-naphthalenesulfonic acid sodium salt; Folin’s reagent
CAS Number: 521-24-4
Empirical Formula (Hill Notation): C10H5NaO5S
Molecular Weight: 260.20
EC Number: 208-308-9
MDL Number: MFCD00001700
Linear Formula: C10H5NaO5S
Product Type: Chemical
| assay |
≥97.0% (HPLC) |
| |
≥97.0% (T) |
| form |
powder |
| InChI |
1S/C10H6O5S.Na/c11-8-5-9(16(13,14)15)6-3-1-2-4-7(6)10(8)12;/h1-5H,(H,13,14,15);/q;+1/p-1 |
| InChI key |
UBLXEEBHYISRFM-UHFFFAOYSA-M |
| quality |
for spectrophotometric det. of isonicotic hydrazide, amines and amino acids |
| SMILES string |
[Na+].[O-]S(=O)(=O)C1=CC(=O)C(=O)c2ccccc12 |
| solubility |
H2O: 50 mg/mL, clear |
| specific analyte(s) |
sodium |
| technique(s) |
photometry: suitable |
| |
UV/Vis spectroscopy: suitable |
| Other Notes: |
Determination of amines |
| Hazard Codes |
Xi |
| Risk Statements |
36/37/38 |
| Safety Statements |
26 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥97.0% (HPLC); ≥97.0% (T) |
| UNSPSC |
12000000 |
