(+)-L-Alliin
SIAL/72805 - analytical standard
Synonym: (S)-S-Allyl-L-cysteine sulfoxide; (S)-L-
CAS Number: 556-27-4
Empirical Formula (Hill Notation): C6H11NO3S
Molecular Weight: 177.22
EC Number: 209-118-9
MDL Number: MFCD00151977
Linear Formula: C6H11NO3S
Product Type: Chemical
| application(s) | food and beverages |
| assay | ≥95.0% (HPLC) |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C6H11NO3S/c1-2-3-11(10 |
| InChI key | XUHLIQGRKRUKPH-ITZCMCNPSA |
| Quality Level | 100 ![]() |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | N[C@@H](CS(=O)CC=C)C(O)=O |
| storage temp. | 2-8°C |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| General description: | (+)-L-Alliin is one of the abundant sulfoxides present in garlic (Allium sp.). It has a characteristic sulfuryl odor. |
| Other Notes: | This compound is commonly found in plants of the genus: allium |
| Packaging: | Bottomless glass bottle. Contents are inside inserted fused cone. |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥95.0% (HPLC) |
| Storage Temp. | 2-8°C |
| UNSPSC | 85151701 |


