Glyceryl tributyrate
SIAL/73105 - analytical standard
Synonym: 1,2,3-
CAS Number: 60-01-5
Empirical Formula (Hill Notation): C15H26O6
Molecular Weight: 302.36
EC Number: 200-451-5
MDL Number: MFCD00009392
Linear Formula: (CH3CH2CH2COOCH2)2CHOCOCH2CH2CH3
Product Type: Chemical
| application(s) | food and beverages |
| assay | ≥98.0% (GC) |
| bp | 129-131 °C/0.03 mmHg (lit.) |
| 287-288 °C (lit.) | |
| density | 1.032 g/mL at 20 °C (lit.) |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C15H26O6/c1-4-7-13(16) |
| InChI key | UYXTWWCETRIEDR-UHFFFAOYSA |
| Quality Level | 100  |
| refractive index | n |
| n |
|
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | CCCC(=O)OCC(COC(=O)CCC)OC |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | 345.2 °F - closed cup |
| Flash Point(C) | 174 °C - closed cup |
| Purity | ≥98.0% (GC) |
| bp | 129-131 °C/0.03 mmHg (lit.); 287-288 °C (lit.) |
| Density | 1.032 g/mL at 20 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 85151701 |