DL-4-Hydroxy-3-methoxymandelic acid
SIAL/73538 - analytical standard
Synonym: α,4-Dihydroxy-3-methoxybenzeneacetic acid; VMA; Vanillomandelic acid; Vanillylmandelic acid; Vanilmandelic acid
CAS Number: 55-10-7
Empirical Formula (Hill Notation): C9H10O5
Molecular Weight: 198.17
EC Number: 200-224-0
MDL Number: MFCD00004235
Linear Formula: HOC6H3(OCH3)CH(OH)CO2H
Product Type: Chemical
| application(s) | clinical testing |
| assay | ≥98.0% (GC) |
| 98.0-102.0% (T) | |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C9H10O5/c1-14-7-4-5(2- |
| InChI key | CGQCWMIAEPEHNQ-UHFFFAOYSA |
| mp | 132-134 °C (dec.) (lit.) |
| Quality Level | 100 ![]() |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | OC1=C(OC)C=C(C(O)C(O)=O)C |
| storage temp. | 2-8°C |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98.0% (GC); 98.0-102.0% (T) |
| mp | 132-134 °C (dec.) (lit.) |
| Storage Temp. | 2-8°C |
| UNSPSC | 41116107 |

