Triacetin
SIAL/74103 - analytical standard
Synonym: 1,2,3-
CAS Number: 102-76-1
Empirical Formula (Hill Notation): C9H14O6
Molecular Weight: 218.20
EC Number: 203-051-9
MDL Number: MFCD00008716
Linear Formula: (CH3COOCH2)2CHOCOCH3
Product Type: Chemical
| application(s) | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| assay | ≥99.0% (GC) |
| autoignition temp. | 809 °F |
| bp | 258 °C (lit.) |
| density | 1.16 g/mL at 25 °C (lit.) |
| expl. lim. | 1.05 %, 189 °F |
| 7.73 %, 215 °F | |
| format | neat |
| grade | analytical standard |
| impurities | ≤0.3% water |
| InChI | 1S/C9H14O6/c1-6(10)13-4-9 |
| InChI key | URAYPUMNDPQOKB-UHFFFAOYSA |
| mp | 3 °C (lit.) |
| Quality Level | 100  |
| refractive index | n |
| n |
|
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | CC(=O)OCC(COC(C)=O)OC(C)= |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable | |
| vapor density | 7.52 (vs air) |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | 280.4 °F - closed cup |
| Flash Point(C) | 138 °C - closed cup |
| Purity | ≥99.0% (GC) |
| bp | 258 °C (lit.) |
| mp | 3 °C (lit.) |
| Density | 1.16 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 85151701 |